C16H18F9NO — CID 101046679
1-[5-ethenyl-3-[(E)-hex-1-enyl]-2,2-bis(trifluoromethyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 101046679) has the molecular formula C16H18F9NO and a molecular weight of 411.31 g/mol. Its IUPAC name is 1-[5-ethenyl-3-[(E)-hex-1-enyl]-2,2-bis(trifluoromethyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[5-ethenyl-3-[(E)-hex-1-enyl]-2,2-bis(trifluoromethyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 101046679 |
| Molecular Formula | C16H18F9NO |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 1-[5-ethenyl-3-[(E)-hex-1-enyl]-2,2-bis(trifluoromethyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | C=CC1CC(/C=C/CCCC)C(C(F)(F)F)(C(F)(F)F)N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H18F9NO/c1-3-5-6-7-8-10-9-11(4-2)26(12(27)14(17,18)19)13(10,15(20,21)22)16(23,24)25/h4,7-8,10-11H,2-3,5-6,9H2,1H3/b8-7+ |
| InChIKey | VCWCQWIUXGKWLN-BQYQJAHWSA-N |
| XLogP | 5.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|