C9H14O4S — CID 101047555
(4aR,8R,8aR)-8-methylsulfonyl-4a,5,8,8a-tetrahydro-4H-1,3-benzodioxine (PubChem CID 101047555) has the molecular formula C9H14O4S and a molecular weight of 218.27 g/mol. Its IUPAC name is (4aR,8R,8aR)-8-methylsulfonyl-4a,5,8,8a-tetrahydro-4H-1,3-benzodioxine.
| Compound Name | (4aR,8R,8aR)-8-methylsulfonyl-4a,5,8,8a-tetrahydro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 101047555 |
| Molecular Formula | C9H14O4S |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | (4aR,8R,8aR)-8-methylsulfonyl-4a,5,8,8a-tetrahydro-4H-1,3-benzodioxine |
| SMILES | CS(=O)(=O)[C@@H]1C=CC[C@@H]2COCO[C@H]21 |
| InChI | InChI=1S/C9H14O4S/c1-14(10,11)8-4-2-3-7-5-12-6-13-9(7)8/h2,4,7-9H,3,5-6H2,1H3/t7-,8-,9-/m1/s1 |
| InChIKey | SRLPNVQKIMFZFM-IWSPIJDZSA-N |
| XLogP | 0.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|