C12H18O8 — CID 538356
[4-(4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)-1,3-dioxan-5-yl] acetate (PubChem CID 538356) has the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. Its IUPAC name is [4-(4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)-1,3-dioxan-5-yl] acetate.
| Compound Name | [4-(4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)-1,3-dioxan-5-yl] acetate |
|---|---|
| PubChem CID | 538356 |
| Molecular Formula | C12H18O8 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | [4-(4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)-1,3-dioxan-5-yl] acetate |
| SMILES | CC(=O)OC1COCOC1C1OCOC2COCOC21 |
| InChI | InChI=1S/C12H18O8/c1-7(13)20-9-3-15-5-18-11(9)12-10-8(16-6-19-12)2-14-4-17-10/h8-12H,2-6H2,1H3 |
| InChIKey | HKHSRLKEEGOKAC-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |