C7H10O2 — CID 130152044
3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-ol (PubChem CID 130152044) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is 3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-ol.
| Compound Name | 3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-ol |
|---|---|
| PubChem CID | 130152044 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 3,3a,6,6a-tetrahydro-1H-cyclopenta[c]furan-3-ol |
| SMILES | OC1OCC2CC=CC21 |
| InChI | InChI=1S/C7H10O2/c8-7-6-3-1-2-5(6)4-9-7/h1,3,5-8H,2,4H2 |
| InChIKey | JFIXYXFEICEOLL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|