C15H17NO2S3 — CID 101047827
naphthalen-2-ylsulfonyl N,N-diethylcarbamodithioate (PubChem CID 101047827) has the molecular formula C15H17NO2S3 and a molecular weight of 339.51 g/mol. Its IUPAC name is naphthalen-2-ylsulfonyl N,N-diethylcarbamodithioate.
| Compound Name | naphthalen-2-ylsulfonyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 101047827 |
| Molecular Formula | C15H17NO2S3 |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | naphthalen-2-ylsulfonyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H17NO2S3/c1-3-16(4-2)15(19)20-21(17,18)14-10-9-12-7-5-6-8-13(12)11-14/h5-11H,3-4H2,1-2H3 |
| InChIKey | GZBYGBQYMWILRN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|