C12H16O4 — CID 101048112
(2R,3S,4R)-2,3,4-triacetylhex-5-enal (PubChem CID 101048112) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (2R,3S,4R)-2,3,4-triacetylhex-5-enal.
| Compound Name | (2R,3S,4R)-2,3,4-triacetylhex-5-enal |
|---|---|
| PubChem CID | 101048112 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (2R,3S,4R)-2,3,4-triacetylhex-5-enal |
| SMILES | C=C[C@@H](C(C)=O)[C@H](C(C)=O)[C@H](C=O)C(C)=O |
| InChI | InChI=1S/C12H16O4/c1-5-10(7(2)14)12(9(4)16)11(6-13)8(3)15/h5-6,10-12H,1H2,2-4H3/t10-,11+,12-/m0/s1 |
| InChIKey | UUBUTBFYOCQIED-TUAOUCFPSA-N |
| XLogP | 0.99 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|