C18H36B2O4 — CID 101048143
4,4,5,5-tetramethyl-2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexyl]-1,3,2-dioxaborolane (PubChem CID 101048143) has the molecular formula C18H36B2O4 and a molecular weight of 338.11 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101048143 |
| Molecular Formula | C18H36B2O4 |
| Molecular Weight | 338.11 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexyl]-1,3,2-dioxaborolane |
| SMILES | CCCCCC(B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H36B2O4/c1-10-11-12-13-14(19-21-15(2,3)16(4,5)22-19)20-23-17(6,7)18(8,9)24-20/h14H,10-13H2,1-9H3 |
| InChIKey | IOGRMRGYHUPYAQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.11 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|