C13H14O2 — CID 101048367
(1S,2R,6S,7R)-spiro[4-oxatricyclo[5.2.1.02,6]dec-8-ene-5,4'-cyclopentene]-3-one (PubChem CID 101048367) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (1S,2R,6S,7R)-spiro[4-oxatricyclo[5.2.1.02,6]dec-8-ene-5,4'-cyclopentene]-3-one.
| Compound Name | (1S,2R,6S,7R)-spiro[4-oxatricyclo[5.2.1.02,6]dec-8-ene-5,4'-cyclopentene]-3-one |
|---|---|
| PubChem CID | 101048367 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (1S,2R,6S,7R)-spiro[4-oxatricyclo[5.2.1.02,6]dec-8-ene-5,4'-cyclopentene]-3-one |
| SMILES | O=C1OC2(CC=CC2)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C13H14O2/c14-12-10-8-3-4-9(7-8)11(10)13(15-12)5-1-2-6-13/h1-4,8-11H,5-7H2/t8-,9+,10-,11+/m1/s1 |
| InChIKey | OTIUDSRWEUITQQ-YTWAJWBKSA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|