C21H45N7O3 — CID 101049099
1-[2-[bis[2-(butylcarbamoylamino)ethyl]amino]ethyl]-3-butylurea (PubChem CID 101049099) has the molecular formula C21H45N7O3 and a molecular weight of 443.64 g/mol. Its IUPAC name is 1-[2-[bis[2-(butylcarbamoylamino)ethyl]amino]ethyl]-3-butylurea.
| Compound Name | 1-[2-[bis[2-(butylcarbamoylamino)ethyl]amino]ethyl]-3-butylurea |
|---|---|
| PubChem CID | 101049099 |
| Molecular Formula | C21H45N7O3 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.36 |
| IUPAC Name | 1-[2-[bis[2-(butylcarbamoylamino)ethyl]amino]ethyl]-3-butylurea |
| SMILES | CCCCNC(=O)NCCN(CCNC(=O)NCCCC)CCNC(=O)NCCCC |
| InChI | InChI=1S/C21H45N7O3/c1-4-7-10-22-19(29)25-13-16-28(17-14-26-20(30)23-11-8-5-2)18-15-27-21(31)24-12-9-6-3/h4-18H2,1-3H3,(H2,22,25,29)(H2,23,26,30)(H2,24,27,31) |
| InChIKey | FPAHIPFWLGJPIO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|