C13H23N3 — CID 10104931
(5S,6R)-5-azido-6,10-dimethylundeca-1,9-diene (PubChem CID 10104931) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is (5S,6R)-5-azido-6,10-dimethylundeca-1,9-diene.
| Compound Name | (5S,6R)-5-azido-6,10-dimethylundeca-1,9-diene |
|---|---|
| PubChem CID | 10104931 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | (5S,6R)-5-azido-6,10-dimethylundeca-1,9-diene |
| SMILES | C=CCC[C@H](N=[N+]=[N-])[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C13H23N3/c1-5-6-10-13(15-16-14)12(4)9-7-8-11(2)3/h5,8,12-13H,1,6-7,9-10H2,2-4H3/t12-,13+/m1/s1 |
| InChIKey | CEZBDYHYBNSMQT-OLZOCXBDSA-N |
| XLogP | 5.01 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|