C11H16O3 — CID 101052019
11-ethyl-1,5-dioxaspiro[5.5]undec-7-en-9-one (PubChem CID 101052019) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 11-ethyl-1,5-dioxaspiro[5.5]undec-7-en-9-one.
| Compound Name | 11-ethyl-1,5-dioxaspiro[5.5]undec-7-en-9-one |
|---|---|
| PubChem CID | 101052019 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 11-ethyl-1,5-dioxaspiro[5.5]undec-7-en-9-one |
| SMILES | CCC1CC(=O)C=CC12OCCCO2 |
| InChI | InChI=1S/C11H16O3/c1-2-9-8-10(12)4-5-11(9)13-6-3-7-14-11/h4-5,9H,2-3,6-8H2,1H3 |
| InChIKey | MEXHXJIZSIHENV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |