C11H16O3 — CID 162419744
3,3-dimethyl-2,4-dioxaspiro[5.5]undec-8-en-10-one (PubChem CID 162419744) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-dioxaspiro[5.5]undec-8-en-10-one.
| Compound Name | 3,3-dimethyl-2,4-dioxaspiro[5.5]undec-8-en-10-one |
|---|---|
| PubChem CID | 162419744 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3,3-dimethyl-2,4-dioxaspiro[5.5]undec-8-en-10-one |
| SMILES | CC1(C)OCC2(CC=CC(=O)C2)CO1 |
| InChI | InChI=1S/C11H16O3/c1-10(2)13-7-11(8-14-10)5-3-4-9(12)6-11/h3-4H,5-8H2,1-2H3 |
| InChIKey | PARHKCNZIPUHMA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |