C16H22O3 — CID 101120541
(4'aR,8'S,8'aS)-5,5,8'-trimethylspiro[1,3-dioxane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one (PubChem CID 101120541) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (4'aR,8'S,8'aS)-5,5,8'-trimethylspiro[1,3-dioxane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one.
| Compound Name | (4'aR,8'S,8'aS)-5,5,8'-trimethylspiro[1,3-dioxane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 101120541 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (4'aR,8'S,8'aS)-5,5,8'-trimethylspiro[1,3-dioxane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one |
| SMILES | C[C@H]1C=CC[C@@H]2[C@H]1C(=O)C=CC21OCC(C)(C)CO1 |
| InChI | InChI=1S/C16H22O3/c1-11-5-4-6-12-14(11)13(17)7-8-16(12)18-9-15(2,3)10-19-16/h4-5,7-8,11-12,14H,6,9-10H2,1-3H3/t11-,12+,14-/m0/s1 |
| InChIKey | KCKAUDYAQWIZGB-SCRDCRAPSA-N |
| XLogP | 2.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|