C17H26O3 — CID 10923896
8-[(E)-hex-1-enyl]-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-8-en-10-one (PubChem CID 10923896) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 8-[(E)-hex-1-enyl]-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-8-en-10-one.
| Compound Name | 8-[(E)-hex-1-enyl]-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-8-en-10-one |
|---|---|
| PubChem CID | 10923896 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 8-[(E)-hex-1-enyl]-3,3-dimethyl-2,4-dioxaspiro[5.5]undec-8-en-10-one |
| SMILES | CCCC/C=C/C1=CC(=O)CC2(COC(C)(C)OC2)C1 |
| InChI | InChI=1S/C17H26O3/c1-4-5-6-7-8-14-9-15(18)11-17(10-14)12-19-16(2,3)20-13-17/h7-9H,4-6,10-13H2,1-3H3/b8-7+ |
| InChIKey | KHWUKJALULROMM-BQYQJAHWSA-N |
| XLogP | 3.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|