C15H22O3 — CID 10901065
(7R)-3,3,10-trimethyl-7-prop-1-en-2-yl-2,4-dioxaspiro[5.5]undec-9-en-11-one (PubChem CID 10901065) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (7R)-3,3,10-trimethyl-7-prop-1-en-2-yl-2,4-dioxaspiro[5.5]undec-9-en-11-one.
| Compound Name | (7R)-3,3,10-trimethyl-7-prop-1-en-2-yl-2,4-dioxaspiro[5.5]undec-9-en-11-one |
|---|---|
| PubChem CID | 10901065 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (7R)-3,3,10-trimethyl-7-prop-1-en-2-yl-2,4-dioxaspiro[5.5]undec-9-en-11-one |
| SMILES | C=C(C)[C@H]1CC=C(C)C(=O)C12COC(C)(C)OC2 |
| InChI | InChI=1S/C15H22O3/c1-10(2)12-7-6-11(3)13(16)15(12)8-17-14(4,5)18-9-15/h6,12H,1,7-9H2,2-5H3/t12-/m1/s1 |
| InChIKey | JTGZBYKQVIGFTM-GFCCVEGCSA-N |
| XLogP | 2.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|