C13H20O3 — CID 45097844
ethyl (1R,5R,6R)-1,3,5,6-tetramethyl-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 45097844) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is ethyl (1R,5R,6R)-1,3,5,6-tetramethyl-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,5R,6R)-1,3,5,6-tetramethyl-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 45097844 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | ethyl (1R,5R,6R)-1,3,5,6-tetramethyl-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)C(=O)C(C)=C[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C13H20O3/c1-6-16-12(15)13(5)10(4)8(2)7-9(3)11(13)14/h7-8,10H,6H2,1-5H3/t8-,10-,13-/m1/s1 |
| InChIKey | OAVPNDQXHFNPJB-ZDSQKVDBSA-N |
| XLogP | 2.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|