C14H24O3 — CID 11241925
(E)-1-(1,3-dioxan-2-yl)-3,7-dimethyloct-5-en-4-one (PubChem CID 11241925) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (E)-1-(1,3-dioxan-2-yl)-3,7-dimethyloct-5-en-4-one.
| Compound Name | (E)-1-(1,3-dioxan-2-yl)-3,7-dimethyloct-5-en-4-one |
|---|---|
| PubChem CID | 11241925 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (E)-1-(1,3-dioxan-2-yl)-3,7-dimethyloct-5-en-4-one |
| SMILES | CC(C)/C=C/C(=O)C(C)CCC1OCCCO1 |
| InChI | InChI=1S/C14H24O3/c1-11(2)5-7-13(15)12(3)6-8-14-16-9-4-10-17-14/h5,7,11-12,14H,4,6,8-10H2,1-3H3/b7-5+ |
| InChIKey | JTXPUEKDNDPVQE-FNORWQNLSA-N |
| XLogP | 2.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|