C16H26O3 — CID 154720694
(5R,6S)-5-(1-ethoxyethoxymethyl)-6-[(E)-3-methylbut-1-enyl]cyclohex-2-en-1-one (PubChem CID 154720694) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (5R,6S)-5-(1-ethoxyethoxymethyl)-6-[(E)-3-methylbut-1-enyl]cyclohex-2-en-1-one.
| Compound Name | (5R,6S)-5-(1-ethoxyethoxymethyl)-6-[(E)-3-methylbut-1-enyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 154720694 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (5R,6S)-5-(1-ethoxyethoxymethyl)-6-[(E)-3-methylbut-1-enyl]cyclohex-2-en-1-one |
| SMILES | CCOC(C)OC[C@@H]1CC=CC(=O)[C@H]1/C=C/C(C)C |
| InChI | InChI=1S/C16H26O3/c1-5-18-13(4)19-11-14-7-6-8-16(17)15(14)10-9-12(2)3/h6,8-10,12-15H,5,7,11H2,1-4H3/b10-9+/t13?,14-,15-/m0/s1 |
| InChIKey | XKAYIZXKYPJBJZ-CQTSEUIMSA-N |
| XLogP | 3.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|