C18H30O3 — CID 11066324
(5R,6R)-6-(3,3-diethoxypropyl)-2,6-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one (PubChem CID 11066324) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (5R,6R)-6-(3,3-diethoxypropyl)-2,6-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one.
| Compound Name | (5R,6R)-6-(3,3-diethoxypropyl)-2,6-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11066324 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (5R,6R)-6-(3,3-diethoxypropyl)-2,6-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
| SMILES | C=C(C)[C@H]1CC=C(C)C(=O)[C@]1(C)CCC(OCC)OCC |
| InChI | InChI=1S/C18H30O3/c1-7-20-16(21-8-2)11-12-18(6)15(13(3)4)10-9-14(5)17(18)19/h9,15-16H,3,7-8,10-12H2,1-2,4-6H3/t15-,18-/m1/s1 |
| InChIKey | COTKPMFLHXNEEY-CRAIPNDOSA-N |
| XLogP | 4.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|