C17H26O2S — CID 101052603
2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 101052603) has the molecular formula C17H26O2S and a molecular weight of 294.46 g/mol. Its IUPAC name is 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 101052603 |
| Molecular Formula | C17H26O2S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C(CCCCCCCCCCCS)=C1 |
| InChI | InChI=1S/C17H26O2S/c18-16-11-12-17(19)15(14-16)10-8-6-4-2-1-3-5-7-9-13-20/h11-12,14,20H,1-10,13H2 |
| InChIKey | JIQPELGVONEEID-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|