About 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione
2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 101052603) has the molecular formula C17H26O2S
and a molecular weight of 294.46 g/mol. Its IUPAC name is 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione.
Molecular Properties
| Compound Name | 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione |
| PubChem CID | 101052603 |
| Molecular Formula | C17H26O2S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C(CCCCCCCCCCCS)=C1 |
| InChI | InChI=1S/C17H26O2S/c18-16-11-12-17(19)15(14-16)10-8-6-4-2-1-3-5-7-9-13-20/h11-12,14,20H,1-10,13H2 |
| InChIKey | JIQPELGVONEEID-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione?
The IUPAC name of 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione (CID 101052603) is 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione.
What is the SMILES notation for 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione?
The canonical SMILES for 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione is O=C1C=CC(=O)C(CCCCCCCCCCCS)=C1.
What is the InChIKey of 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione?
The InChIKey is JIQPELGVONEEID-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O2S/c18-16-11-12-17(19)15(14-16)10-8-6-4-2-1-3-5-7-9-13-20/h11-12,14,20H,1-10,13H2.
What are the key properties of 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione?
2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione has a molecular weight of 294.46 g/mol, XLogP of 4.45, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(11-sulfanylundecyl)cyclohexa-2,5-diene-1,4-dione is sourced from PubChem (CID 101052603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).