C18H18O4 — CID 2729485
2-[6-(3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 2729485) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[6-(3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[6-(3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 2729485 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-[6-(3,6-dioxocyclohexa-1,4-dien-1-yl)hexyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C(CCCCCCC2=CC(=O)C=CC2=O)=C1 |
| InChI | InChI=1S/C18H18O4/c19-15-7-9-17(21)13(11-15)5-3-1-2-4-6-14-12-16(20)8-10-18(14)22/h7-12H,1-6H2 |
| InChIKey | QMALBHPXVWGLBW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|