C25H38O2 — CID 101055032
(8S,9S,10R,13S,14S,17R)-17-[(2S)-3-hydroxyhex-5-en-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 101055032) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-17-[(2S)-3-hydroxyhex-5-en-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17R)-17-[(2S)-3-hydroxyhex-5-en-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 101055032 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-17-[(2S)-3-hydroxyhex-5-en-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=CCC(O)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H38O2/c1-5-6-23(27)16(2)20-9-10-21-19-8-7-17-15-18(26)11-13-24(17,3)22(19)12-14-25(20,21)4/h5,15-16,19-23,27H,1,6-14H2,2-4H3/t16-,19-,20+,21-,22-,23?,24-,25+/m0/s1 |
| InChIKey | KIVHMQYHGAOJBN-ABSTUWSSSA-N |
| XLogP | 5.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|