C28H44O2 — CID 102271705
(8S,9S,10R,13S,14S)-17-[(2S,3S,5S)-3-hydroxy-5,6-dimethylhept-6-en-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 102271705) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-17-[(2S,3S,5S)-3-hydroxy-5,6-dimethylhept-6-en-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S)-17-[(2S,3S,5S)-3-hydroxy-5,6-dimethylhept-6-en-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 102271705 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | (8S,9S,10R,13S,14S)-17-[(2S,3S,5S)-3-hydroxy-5,6-dimethylhept-6-en-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C(C)[C@@H](C)C[C@H](O)[C@@H](C)C1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H44O2/c1-17(2)18(3)15-26(30)19(4)23-9-10-24-22-8-7-20-16-21(29)11-13-27(20,5)25(22)12-14-28(23,24)6/h16,18-19,22-26,30H,1,7-15H2,2-6H3/t18-,19-,22-,23?,24-,25-,26-,27-,28+/m0/s1 |
| InChIKey | OOXSREBDYUZLTB-WSQGVBPUSA-N |
| XLogP | 6.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|