C13H21NO2 — CID 101055450
N-tert-butyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide (PubChem CID 101055450) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is N-tert-butyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide.
| Compound Name | N-tert-butyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 101055450 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | N-tert-butyl-N,3,3-trimethyl-5-oxocyclopentene-1-carboxamide |
| SMILES | CN(C(=O)C1=CC(C)(C)CC1=O)C(C)(C)C |
| InChI | InChI=1S/C13H21NO2/c1-12(2,3)14(6)11(16)9-7-13(4,5)8-10(9)15/h7H,8H2,1-6H3 |
| InChIKey | JCPZLCRHLANQQU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|