C17H29NO2 — CID 160638741
1-tert-butyl-3-(3,3-dimethylbutanoyl)pyridin-2-one;ethane (PubChem CID 160638741) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 1-tert-butyl-3-(3,3-dimethylbutanoyl)pyridin-2-one;ethane.
| Compound Name | 1-tert-butyl-3-(3,3-dimethylbutanoyl)pyridin-2-one;ethane |
|---|---|
| PubChem CID | 160638741 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 1-tert-butyl-3-(3,3-dimethylbutanoyl)pyridin-2-one;ethane |
| SMILES | CC.CC(C)(C)CC(=O)c1cccn(C(C)(C)C)c1=O |
| InChI | InChI=1S/C15H23NO2.C2H6/c1-14(2,3)10-12(17)11-8-7-9-16(13(11)18)15(4,5)6;1-2/h7-9H,10H2,1-6H3;1-2H3 |
| InChIKey | RIWRCMAWLZCAAA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |