C23H34N2O2 — CID 146512701
3-[4-(3-tert-butyl-2-oxo-1-pyridinyl)-2-methylpentan-2-yl]-1-propan-2-ylpyridin-2-one (PubChem CID 146512701) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 3-[4-(3-tert-butyl-2-oxo-1-pyridinyl)-2-methylpentan-2-yl]-1-propan-2-ylpyridin-2-one.
| Compound Name | 3-[4-(3-tert-butyl-2-oxo-1-pyridinyl)-2-methylpentan-2-yl]-1-propan-2-ylpyridin-2-one |
|---|---|
| PubChem CID | 146512701 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 3-[4-(3-tert-butyl-2-oxo-1-pyridinyl)-2-methylpentan-2-yl]-1-propan-2-ylpyridin-2-one |
| SMILES | CC(C)n1cccc(C(C)(C)CC(C)n2cccc(C(C)(C)C)c2=O)c1=O |
| InChI | InChI=1S/C23H34N2O2/c1-16(2)24-13-10-12-19(21(24)27)23(7,8)15-17(3)25-14-9-11-18(20(25)26)22(4,5)6/h9-14,16-17H,15H2,1-8H3 |
| InChIKey | XBVSUMIALVYZCX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |