C20H26F2N2O2 — CID 178099278
1-[4-(1-ethyl-5-fluoro-2-oxo-3-pyridinyl)pentyl]-4-fluoro-3-propan-2-ylpyridin-2-one (PubChem CID 178099278) has the molecular formula C20H26F2N2O2 and a molecular weight of 364.44 g/mol. Its IUPAC name is 1-[4-(1-ethyl-5-fluoro-2-oxo-3-pyridinyl)pentyl]-4-fluoro-3-propan-2-ylpyridin-2-one.
| Compound Name | 1-[4-(1-ethyl-5-fluoro-2-oxo-3-pyridinyl)pentyl]-4-fluoro-3-propan-2-ylpyridin-2-one |
|---|---|
| PubChem CID | 178099278 |
| Molecular Formula | C20H26F2N2O2 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-[4-(1-ethyl-5-fluoro-2-oxo-3-pyridinyl)pentyl]-4-fluoro-3-propan-2-ylpyridin-2-one |
| SMILES | CCn1cc(F)cc(C(C)CCCn2ccc(F)c(C(C)C)c2=O)c1=O |
| InChI | InChI=1S/C20H26F2N2O2/c1-5-23-12-15(21)11-16(19(23)25)14(4)7-6-9-24-10-8-17(22)18(13(2)3)20(24)26/h8,10-14H,5-7,9H2,1-4H3 |
| InChIKey | VURGUGDIGZBGCD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |