C16H20F2NO3- — CID 131746540
3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylate (PubChem CID 131746540) has the molecular formula C16H20F2NO3- and a molecular weight of 312.34 g/mol. Its IUPAC name is 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylate.
| Compound Name | 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylate |
|---|---|
| PubChem CID | 131746540 |
| Molecular Formula | C16H20F2NO3- |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 3-butyl-4-(4,4-difluorocyclohexyl)-2-oxopyridine-1-carboxylate |
| SMILES | CCCCc1c(C2CCC(F)(F)CC2)ccn(C(=O)[O-])c1=O |
| InChI | InChI=1S/C16H21F2NO3/c1-2-3-4-13-12(7-10-19(14(13)20)15(21)22)11-5-8-16(17,18)9-6-11/h7,10-11H,2-6,8-9H2,1H3,(H,21,22)/p-1 |
| InChIKey | DOWAKWYYZWQFMG-UHFFFAOYSA-M |
| XLogP | 2.68 |
| TPSA | 62.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |