C20H28N2O2 — CID 134233435
5-[4-(4-tert-butyl-2-oxo-1-pyridinyl)-2-methylbutan-2-yl]-1-methylpyridin-2-one (PubChem CID 134233435) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 5-[4-(4-tert-butyl-2-oxo-1-pyridinyl)-2-methylbutan-2-yl]-1-methylpyridin-2-one.
| Compound Name | 5-[4-(4-tert-butyl-2-oxo-1-pyridinyl)-2-methylbutan-2-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 134233435 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 5-[4-(4-tert-butyl-2-oxo-1-pyridinyl)-2-methylbutan-2-yl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(C(C)(C)CCn2ccc(C(C)(C)C)cc2=O)ccc1=O |
| InChI | InChI=1S/C20H28N2O2/c1-19(2,3)15-9-11-22(18(24)13-15)12-10-20(4,5)16-7-8-17(23)21(6)14-16/h7-9,11,13-14H,10,12H2,1-6H3 |
| InChIKey | HFODUTZVXLGRLE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |