C24H35NO3Si — CID 101055840
[(4R,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,6,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 101055840) has the molecular formula C24H35NO3Si and a molecular weight of 413.63 g/mol. Its IUPAC name is [(4R,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,6,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4R,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,6,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101055840 |
| Molecular Formula | C24H35NO3Si |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | [(4R,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,6,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC=C4[C@@H](C2)N(C)CC[C@]431 |
| InChI | InChI=1S/C24H35NO3Si/c1-23(2,3)29(6,7)28-19-11-9-16-17-14-15-8-10-18(26-5)21-20(15)24(16,22(19)27-21)12-13-25(17)4/h8-10,17,19,22H,11-14H2,1-7H3/t17-,19+,22+,24+/m1/s1 |
| InChIKey | AGOUQHJJWBMQRG-YQOCOVSOSA-N |
| XLogP | 4.67 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|