C16H20O5 — CID 101056047
dimethyl (3aR,7R)-7-formyl-8-methyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate (PubChem CID 101056047) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is dimethyl (3aR,7R)-7-formyl-8-methyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aR,7R)-7-formyl-8-methyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101056047 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | dimethyl (3aR,7R)-7-formyl-8-methyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C(C)[C@H](C=O)CC=C[C@H]2C1 |
| InChI | InChI=1S/C16H20O5/c1-10-12(9-17)6-4-5-11-7-16(8-13(10)11,14(18)20-2)15(19)21-3/h4-5,9,11-12H,6-8H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | SOERBDOBDWFEHJ-RYUDHWBXSA-N |
| XLogP | 1.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|