C10H6F6N2O2 — CID 101057684
N-(2-aminophenyl)-2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)acetamide (PubChem CID 101057684) has the molecular formula C10H6F6N2O2 and a molecular weight of 300.16 g/mol. Its IUPAC name is N-(2-aminophenyl)-2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)acetamide.
| Compound Name | N-(2-aminophenyl)-2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)acetamide |
|---|---|
| PubChem CID | 101057684 |
| Molecular Formula | C10H6F6N2O2 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | N-(2-aminophenyl)-2,2,2-trifluoro-N-(2,2,2-trifluoroacetyl)acetamide |
| SMILES | Nc1ccccc1N(C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H6F6N2O2/c11-9(12,13)7(19)18(8(20)10(14,15)16)6-4-2-1-3-5(6)17/h1-4H,17H2 |
| InChIKey | DPOGPSIMYABVNH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|