C19H34F3N3O — CID 142529747
N-(2-aminophenyl)-5,5,5-trifluoro-2,2,3,3-tetramethylpentanehydrazide;ethane (PubChem CID 142529747) has the molecular formula C19H34F3N3O and a molecular weight of 377.50 g/mol. Its IUPAC name is N-(2-aminophenyl)-5,5,5-trifluoro-2,2,3,3-tetramethylpentanehydrazide;ethane.
| Compound Name | N-(2-aminophenyl)-5,5,5-trifluoro-2,2,3,3-tetramethylpentanehydrazide;ethane |
|---|---|
| PubChem CID | 142529747 |
| Molecular Formula | C19H34F3N3O |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | N-(2-aminophenyl)-5,5,5-trifluoro-2,2,3,3-tetramethylpentanehydrazide;ethane |
| SMILES | CC.CC.CC(C)(CC(F)(F)F)C(C)(C)C(=O)N(N)c1ccccc1N |
| InChI | InChI=1S/C15H22F3N3O.2C2H6/c1-13(2,9-15(16,17)18)14(3,4)12(22)21(20)11-8-6-5-7-10(11)19;2*1-2/h5-8H,9,19-20H2,1-4H3;2*1-2H3 |
| InChIKey | JPMQBMYQXPWJDD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|