C9H10F3N3O — CID 57193605
2-amino-N-(2,2,2-trifluoroethyl)benzohydrazide (PubChem CID 57193605) has the molecular formula C9H10F3N3O and a molecular weight of 233.19 g/mol. Its IUPAC name is 2-amino-N-(2,2,2-trifluoroethyl)benzohydrazide.
| Compound Name | 2-amino-N-(2,2,2-trifluoroethyl)benzohydrazide |
|---|---|
| PubChem CID | 57193605 |
| Molecular Formula | C9H10F3N3O |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-amino-N-(2,2,2-trifluoroethyl)benzohydrazide |
| SMILES | Nc1ccccc1C(=O)N(N)CC(F)(F)F |
| InChI | InChI=1S/C9H10F3N3O/c10-9(11,12)5-15(14)8(16)6-3-1-2-4-7(6)13/h1-4H,5,13-14H2 |
| InChIKey | BMMJSOIVUBRDNU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|