C10H10F3NO — CID 15256877
2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)acetamide (PubChem CID 15256877) has the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 15256877 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1N(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO/c1-7-5-3-4-6-8(7)14(2)9(15)10(11,12)13/h3-6H,1-2H3 |
| InChIKey | YEXXRAVVOQDXOJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |