C14H20O5 — CID 101058333
tert-butyl 2-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)propanoate (PubChem CID 101058333) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is tert-butyl 2-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)propanoate.
| Compound Name | tert-butyl 2-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)propanoate |
|---|---|
| PubChem CID | 101058333 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | tert-butyl 2-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)propanoate |
| SMILES | CC(C)Oc1c(C(C)C(=O)OC(C)(C)C)c(=O)c1=O |
| InChI | InChI=1S/C14H20O5/c1-7(2)18-12-9(10(15)11(12)16)8(3)13(17)19-14(4,5)6/h7-8H,1-6H3 |
| InChIKey | HCAASHOMEYHPSN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|