C24H37NO9 — CID 11620002
ditert-butyl 2-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 11620002) has the molecular formula C24H37NO9 and a molecular weight of 483.56 g/mol. Its IUPAC name is ditert-butyl 2-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | ditert-butyl 2-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 11620002 |
| Molecular Formula | C24H37NO9 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | ditert-butyl 2-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | CC(C)Oc1c(C(CC(=O)OC(C)(C)C)(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c(=O)c1=O |
| InChI | InChI=1S/C24H37NO9/c1-13(2)31-18-15(16(27)17(18)28)24(19(29)33-22(6,7)8,12-14(26)32-21(3,4)5)25-20(30)34-23(9,10)11/h13H,12H2,1-11H3,(H,25,30) |
| InChIKey | FGLKFOMMIFVTAA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|