C11H19NO2 — CID 101060319
methyl 2-[methyl-[(2E)-penta-2,4-dienyl]amino]butanoate (PubChem CID 101060319) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is methyl 2-[methyl-[(2E)-penta-2,4-dienyl]amino]butanoate.
| Compound Name | methyl 2-[methyl-[(2E)-penta-2,4-dienyl]amino]butanoate |
|---|---|
| PubChem CID | 101060319 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | methyl 2-[methyl-[(2E)-penta-2,4-dienyl]amino]butanoate |
| SMILES | C=C/C=C/CN(C)C(CC)C(=O)OC |
| InChI | InChI=1S/C11H19NO2/c1-5-7-8-9-12(3)10(6-2)11(13)14-4/h5,7-8,10H,1,6,9H2,2-4H3/b8-7+ |
| InChIKey | OXMGIXFDHDDPKK-BQYQJAHWSA-N |
| XLogP | 1.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|