C9H15NO2 — CID 134927445
methyl 2-[methyl-[(2Z)-penta-2,4-dienyl]amino]acetate (PubChem CID 134927445) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is methyl 2-[methyl-[(2Z)-penta-2,4-dienyl]amino]acetate.
| Compound Name | methyl 2-[methyl-[(2Z)-penta-2,4-dienyl]amino]acetate |
|---|---|
| PubChem CID | 134927445 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | methyl 2-[methyl-[(2Z)-penta-2,4-dienyl]amino]acetate |
| SMILES | C=C/C=C\CN(C)CC(=O)OC |
| InChI | InChI=1S/C9H15NO2/c1-4-5-6-7-10(2)8-9(11)12-3/h4-6H,1,7-8H2,2-3H3/b6-5- |
| InChIKey | MEHMPNQYMPNFKZ-WAYWQWQTSA-N |
| XLogP | 0.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|