C16H29NO2 — CID 143971268
2-[[(2E,4Z)-hepta-2,4,6-trienyl]-methylamino]acetic acid;2-methylpentane (PubChem CID 143971268) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is 2-[[(2E,4Z)-hepta-2,4,6-trienyl]-methylamino]acetic acid;2-methylpentane.
| Compound Name | 2-[[(2E,4Z)-hepta-2,4,6-trienyl]-methylamino]acetic acid;2-methylpentane |
|---|---|
| PubChem CID | 143971268 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 2-[[(2E,4Z)-hepta-2,4,6-trienyl]-methylamino]acetic acid;2-methylpentane |
| SMILES | C=C/C=C\C=C\CN(C)CC(=O)O.CCCC(C)C |
| InChI | InChI=1S/C10H15NO2.C6H14/c1-3-4-5-6-7-8-11(2)9-10(12)13;1-4-5-6(2)3/h3-7H,1,8-9H2,2H3,(H,12,13);6H,4-5H2,1-3H3/b5-4-,7-6+; |
| InChIKey | LKSMWFDWUXIPPK-YLKXMWBMSA-N |
| XLogP | 3.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|