C16H21NO4S — CID 101060786
propan-2-yl (2S,3S)-3-acetamido-2-acetylsulfanyl-3-phenylpropanoate (PubChem CID 101060786) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is propan-2-yl (2S,3S)-3-acetamido-2-acetylsulfanyl-3-phenylpropanoate.
| Compound Name | propan-2-yl (2S,3S)-3-acetamido-2-acetylsulfanyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 101060786 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | propan-2-yl (2S,3S)-3-acetamido-2-acetylsulfanyl-3-phenylpropanoate |
| SMILES | CC(=O)N[C@@H](c1ccccc1)[C@H](SC(C)=O)C(=O)OC(C)C |
| InChI | InChI=1S/C16H21NO4S/c1-10(2)21-16(20)15(22-12(4)19)14(17-11(3)18)13-8-6-5-7-9-13/h5-10,14-15H,1-4H3,(H,17,18)/t14-,15-/m0/s1 |
| InChIKey | MNLPNBSOECJTNZ-GJZGRUSLSA-N |
| XLogP | 2.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|