C19H30O2Si — CID 101062052
(6S)-6-methoxy-3,3,6-trimethyl-8a-(2-trimethylsilylethynyl)-2,4,4a,5-tetrahydronaphthalen-1-one (PubChem CID 101062052) has the molecular formula C19H30O2Si and a molecular weight of 318.53 g/mol. Its IUPAC name is (6S)-6-methoxy-3,3,6-trimethyl-8a-(2-trimethylsilylethynyl)-2,4,4a,5-tetrahydronaphthalen-1-one.
| Compound Name | (6S)-6-methoxy-3,3,6-trimethyl-8a-(2-trimethylsilylethynyl)-2,4,4a,5-tetrahydronaphthalen-1-one |
|---|---|
| PubChem CID | 101062052 |
| Molecular Formula | C19H30O2Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (6S)-6-methoxy-3,3,6-trimethyl-8a-(2-trimethylsilylethynyl)-2,4,4a,5-tetrahydronaphthalen-1-one |
| SMILES | CO[C@]1(C)C=CC2(C#C[Si](C)(C)C)C(=O)CC(C)(C)CC2C1 |
| InChI | InChI=1S/C19H30O2Si/c1-17(2)12-15-13-18(3,21-4)8-9-19(15,16(20)14-17)10-11-22(5,6)7/h8-9,15H,12-14H2,1-7H3/t15?,18-,19?/m1/s1 |
| InChIKey | YXWZOQHNULCCJM-ZCDLSOSASA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|