C14H22O2 — CID 101051753
(4aR,6R)-6-methoxy-3,3,6-trimethyl-4,4a,5,8a-tetrahydro-2H-naphthalen-1-one (PubChem CID 101051753) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (4aR,6R)-6-methoxy-3,3,6-trimethyl-4,4a,5,8a-tetrahydro-2H-naphthalen-1-one.
| Compound Name | (4aR,6R)-6-methoxy-3,3,6-trimethyl-4,4a,5,8a-tetrahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 101051753 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (4aR,6R)-6-methoxy-3,3,6-trimethyl-4,4a,5,8a-tetrahydro-2H-naphthalen-1-one |
| SMILES | CO[C@@]1(C)C=CC2C(=O)CC(C)(C)C[C@@H]2C1 |
| InChI | InChI=1S/C14H22O2/c1-13(2)7-10-8-14(3,16-4)6-5-11(10)12(15)9-13/h5-6,10-11H,7-9H2,1-4H3/t10-,11?,14+/m1/s1 |
| InChIKey | RERPHOCPYUQKEY-JENJKZFGSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|