C22H36O3 — CID 142894679
1-(1-ethyl-7,10-dimethoxy-2,4b-dimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthren-2-yl)ethanone (PubChem CID 142894679) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is 1-(1-ethyl-7,10-dimethoxy-2,4b-dimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthren-2-yl)ethanone.
| Compound Name | 1-(1-ethyl-7,10-dimethoxy-2,4b-dimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthren-2-yl)ethanone |
|---|---|
| PubChem CID | 142894679 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 1-(1-ethyl-7,10-dimethoxy-2,4b-dimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthren-2-yl)ethanone |
| SMILES | CCC1C2C(OC)C=C3CC(OC)CCC3(C)C2CCC1(C)C(C)=O |
| InChI | InChI=1S/C22H36O3/c1-7-17-20-18(9-11-21(17,3)14(2)23)22(4)10-8-16(24-5)12-15(22)13-19(20)25-6/h13,16-20H,7-12H2,1-6H3 |
| InChIKey | XGYRQDGTRXAXNU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|