C20H30O2 — CID 101051755
(4aR,6S,8aR)-8a-(3,3-dimethylbut-1-ynyl)-6-methoxy-3,3,6-trimethyl-2,4,4a,5-tetrahydronaphthalen-1-one (PubChem CID 101051755) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (4aR,6S,8aR)-8a-(3,3-dimethylbut-1-ynyl)-6-methoxy-3,3,6-trimethyl-2,4,4a,5-tetrahydronaphthalen-1-one.
| Compound Name | (4aR,6S,8aR)-8a-(3,3-dimethylbut-1-ynyl)-6-methoxy-3,3,6-trimethyl-2,4,4a,5-tetrahydronaphthalen-1-one |
|---|---|
| PubChem CID | 101051755 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (4aR,6S,8aR)-8a-(3,3-dimethylbut-1-ynyl)-6-methoxy-3,3,6-trimethyl-2,4,4a,5-tetrahydronaphthalen-1-one |
| SMILES | CO[C@]1(C)C=C[C@]2(C#CC(C)(C)C)C(=O)CC(C)(C)C[C@@H]2C1 |
| InChI | InChI=1S/C20H30O2/c1-17(2,3)8-10-20-11-9-19(6,22-7)13-15(20)12-18(4,5)14-16(20)21/h9,11,15H,12-14H2,1-7H3/t15-,19-,20+/m1/s1 |
| InChIKey | YKBGZJAROTYBKY-YSGRDPCXSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|