C22H28O2 — CID 154694667
(8S,9R,10S,13R,14R,17S)-13-ethyl-17-ethynyl-17-methoxy-1,2,6,7,8,9,10,11,12,14-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 154694667) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is (8S,9R,10S,13R,14R,17S)-13-ethyl-17-ethynyl-17-methoxy-1,2,6,7,8,9,10,11,12,14-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,13R,14R,17S)-13-ethyl-17-ethynyl-17-methoxy-1,2,6,7,8,9,10,11,12,14-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154694667 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (8S,9R,10S,13R,14R,17S)-13-ethyl-17-ethynyl-17-methoxy-1,2,6,7,8,9,10,11,12,14-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C#C[C@@]1(OC)C=C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@H]4[C@@H]3CC[C@]21CC |
| InChI | InChI=1S/C22H28O2/c1-4-21-12-10-18-17-9-7-16(23)14-15(17)6-8-19(18)20(21)11-13-22(21,5-2)24-3/h2,11,13-14,17-20H,4,6-10,12H2,1,3H3/t17-,18+,19+,20-,21-,22-/m1/s1 |
| InChIKey | VKPGKYHHZYJSCQ-VFPNFYTQSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|