C20H21ClN2O2 — CID 101062094
7-chloro-3-(1-hydroxybutyl)-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 101062094) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is 7-chloro-3-(1-hydroxybutyl)-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | 7-chloro-3-(1-hydroxybutyl)-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 101062094 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 7-chloro-3-(1-hydroxybutyl)-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CCCC(O)C1N=C(c2ccccc2)c2cc(Cl)ccc2N(C)C1=O |
| InChI | InChI=1S/C20H21ClN2O2/c1-3-7-17(24)19-20(25)23(2)16-11-10-14(21)12-15(16)18(22-19)13-8-5-4-6-9-13/h4-6,8-12,17,19,24H,3,7H2,1-2H3 |
| InChIKey | QRBDUAPGAUAGAE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |