C21H28O4SSi — CID 101062126
(3'S,4'aS,8'S,8'aS)-3'-phenylsulfanyl-8'-trimethylsilyloxyspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydronaphthalene]-1'-one (PubChem CID 101062126) has the molecular formula C21H28O4SSi and a molecular weight of 404.60 g/mol. Its IUPAC name is (3'S,4'aS,8'S,8'aS)-3'-phenylsulfanyl-8'-trimethylsilyloxyspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydronaphthalene]-1'-one.
| Compound Name | (3'S,4'aS,8'S,8'aS)-3'-phenylsulfanyl-8'-trimethylsilyloxyspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 101062126 |
| Molecular Formula | C21H28O4SSi |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (3'S,4'aS,8'S,8'aS)-3'-phenylsulfanyl-8'-trimethylsilyloxyspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydronaphthalene]-1'-one |
| SMILES | C[Si](C)(C)O[C@H]1C=CC[C@H]2[C@@H]1C(=O)C[C@H](Sc1ccccc1)C21OCCO1 |
| InChI | InChI=1S/C21H28O4SSi/c1-27(2,3)25-18-11-7-10-16-20(18)17(22)14-19(21(16)23-12-13-24-21)26-15-8-5-4-6-9-15/h4-9,11,16,18-20H,10,12-14H2,1-3H3/t16-,18-,19-,20+/m0/s1 |
| InChIKey | YKJKCESVRUJQHF-FRYIKTPZSA-N |
| XLogP | 4.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|