C18H20O4S — CID 101062129
(3'S,4'aS,8'R,8'aS)-8'-hydroxy-3'-phenylsulfanylspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydronaphthalene]-1'-one (PubChem CID 101062129) has the molecular formula C18H20O4S and a molecular weight of 332.42 g/mol. Its IUPAC name is (3'S,4'aS,8'R,8'aS)-8'-hydroxy-3'-phenylsulfanylspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydronaphthalene]-1'-one.
| Compound Name | (3'S,4'aS,8'R,8'aS)-8'-hydroxy-3'-phenylsulfanylspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 101062129 |
| Molecular Formula | C18H20O4S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (3'S,4'aS,8'R,8'aS)-8'-hydroxy-3'-phenylsulfanylspiro[1,3-dioxolane-2,4'-2,3,4a,5,8,8a-hexahydronaphthalene]-1'-one |
| SMILES | O=C1C[C@H](Sc2ccccc2)C2(OCCO2)[C@H]2CC=C[C@@H](O)[C@@H]12 |
| InChI | InChI=1S/C18H20O4S/c19-14-8-4-7-13-17(14)15(20)11-16(18(13)21-9-10-22-18)23-12-5-2-1-3-6-12/h1-6,8,13-14,16-17,19H,7,9-11H2/t13-,14+,16-,17-/m0/s1 |
| InChIKey | ICVAAECZMPYRKZ-FSDCSDTHSA-N |
| XLogP | 2.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|