C12H15N3O6 — CID 101062813
(2R,3R,4S,5R,6R)-2-(4-azido-3-tritiophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 101062813) has the molecular formula C12H15N3O6 and a molecular weight of 299.28 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(4-azido-3-tritiophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(4-azido-3-tritiophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 101062813 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(4-azido-3-tritiophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | [3H]c1cc(O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)ccc1N=[N+]=[N-] |
| InChI | InChI=1S/C12H15N3O6/c13-15-14-6-1-3-7(4-2-6)20-12-11(19)10(18)9(17)8(5-16)21-12/h1-4,8-12,16-19H,5H2/t8-,9+,10+,11-,12+/m1/s1/i1T |
| InChIKey | XNEQKXXRWVEJND-BTTULOJASA-N |
| XLogP | -0.19 |
| TPSA | 148.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|